CAS 31447-86-6 appears in our catalog under these names: Dihydropenicillin F Potassium Salt, Dihydropenicillin F potassium. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2mg, 1mg, 5mg, 10mg, 25mg.
Potassium (2S,5R,6R)-6-(hexanoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (CAS 31447-86-6) is a chemical compound with the molecular formula C14H21KN2O4S and a molecular weight of 352.49 g/mol. IUPAC name: potassium (2S,5R,6R)-6-(hexanoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate. InChIKey: GHSIMVHRSLHNKI-QQQUOLKDSA-M.
| Molecular formula | C14H21KN2O4S |
|---|---|
| Molecular weight | 352.49 g/mol |
| IUPAC name | potassium (2S,5R,6R)-6-(hexanoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChIKey | GHSIMVHRSLHNKI-QQQUOLKDSA-M |
| SMILES | CCCCCC(=O)N[C@H]1[C@@H]2N(C1=O)[C@H](C(S2)(C)C)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)