CAS 31461-63-9 appears in our catalog under these names: H–Gly–Lys–OH · HCl, H-Gly-Lys-OH·HCl, H-Gly-Lys-OH HCl 97%. Offered by: GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 1000mg, 2000mg, 5000mg, 50mg, 100mg, 250mg.
(2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;dihydrochloride (CAS 31461-63-9) is a chemical compound with the molecular formula C8H19Cl2N3O3 and a molecular weight of 276.16 g/mol. IUPAC name: (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;dihydrochloride. InChIKey: FSGICWHRIZBISV-ILKKLZGPSA-N.
| Molecular formula | C8H19Cl2N3O3 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;dihydrochloride |
| InChIKey | FSGICWHRIZBISV-ILKKLZGPSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)O)NC(=O)CN.Cl.Cl |
Computed by PubChem (NCBI)