Products 31477-60-8
CAS 31477-60-8 appears in our catalog under these names: Centchroman, Ormeloxifene, rel-Levormeloxifene. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 500mg, 10mg, 5mg, 25mg, 10 mg, 25 mg, 5 mg.
1-[2-[4-[(3R,4R)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl]phenoxy]ethyl]pyrrolidine (CAS 31477-60-8) is a chemical compound with the molecular formula C30H35NO3 and a molecular weight of 457.6 g/mol. IUPAC name: 1-[2-[4-[(3R,4R)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl]phenoxy]ethyl]pyrrolidine. InChIKey: XZEUAXYWNKYKPL-WDYNHAJCSA-N.
| Molecular formula | C30H35NO3 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | 1-[2-[4-[(3R,4R)-7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl]phenoxy]ethyl]pyrrolidine |
| InChIKey | XZEUAXYWNKYKPL-WDYNHAJCSA-N |
| SMILES | CC1([C@H]([C@@H](C2=C(O1)C=C(C=C2)OC)C3=CC=C(C=C3)OCCN4CCCC4)C5=CC=CC=C5)C |
Computed by PubChem (NCBI)