CAS 3148-72-9 appears in our catalog under these names: 1,3-Diamino-2-propanol-n,n,n',n'-tetraacetic acid, 98%, 1,3–Diamino–2–propanol–N,N,N',N'–tetraacetic Acid, diaminohydroxypropanetetraacetic acid, 1,3-Diamino-2-propanol-N,N,N',N'-tetraacetic Acid, >98.0%(T), DHPTA 98%. Offered by: Combi-blocks, GLPBio, TargetMol, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 2mg, 5mg, 10mg, 25mg, 50mg.
2-[[3-[bis(carboxymethyl)amino]-2-hydroxypropyl]-(carboxymethyl)amino]acetic acid (CAS 3148-72-9) is a chemical compound with the molecular formula C11H18N2O9 and a molecular weight of 322.27 g/mol. IUPAC name: 2-[[3-[bis(carboxymethyl)amino]-2-hydroxypropyl]-(carboxymethyl)amino]acetic acid. InChIKey: WYMDDFRYORANCC-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O9 |
|---|---|
| Molecular weight | 322.27 g/mol |
| IUPAC name | 2-[[3-[bis(carboxymethyl)amino]-2-hydroxypropyl]-(carboxymethyl)amino]acetic acid |
| InChIKey | WYMDDFRYORANCC-UHFFFAOYSA-N |
| SMILES | C(C(CN(CC(=O)O)CC(=O)O)O)N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)