CAS 31499-19-1 is the registry number for rac-(3R,5R)-1,3,5-Trimethylpiperidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3R,5R)-1,3,5-trimethylpiperidin-4-one (CAS 31499-19-1) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. IUPAC name: (3R,5R)-1,3,5-trimethylpiperidin-4-one. InChIKey: QSEAGQPIZOIBLN-RNFRBKRXSA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | (3R,5R)-1,3,5-trimethylpiperidin-4-one |
| InChIKey | QSEAGQPIZOIBLN-RNFRBKRXSA-N |
| SMILES | C[C@@H]1CN(C[C@H](C1=O)C)C |
Computed by PubChem (NCBI)