CAS 3151-41-5 appears in our catalog under these names: Tribenzyltin chloride, 95%, Tribenzyltin chloride. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 5g.
Tribenzyl(chloro)stannane (CAS 3151-41-5) is a chemical compound with the molecular formula C21H21ClSn and a molecular weight of 427.6 g/mol. IUPAC name: tribenzyl(chloro)stannane. InChIKey: PUFMEHZUXSPPAM-UHFFFAOYSA-M.
| Molecular formula | C21H21ClSn |
|---|---|
| Molecular weight | 427.6 g/mol |
| IUPAC name | tribenzyl(chloro)stannane |
| InChIKey | PUFMEHZUXSPPAM-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C[Sn](CC2=CC=CC=C2)(CC3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)