Products 315195-18-7
CAS 315195-18-7 is the registry number for BH3I-2'. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2-hydroxy-3-iodobenzamide (CAS 315195-18-7) is a chemical compound with the molecular formula C19H11Cl3INO4S and a molecular weight of 582.6 g/mol. IUPAC name: 5-chloro-N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2-hydroxy-3-iodobenzamide. InChIKey: XGTQWEPDCQCNBF-UHFFFAOYSA-N.
| Molecular formula | C19H11Cl3INO4S |
|---|---|
| Molecular weight | 582.6 g/mol |
| IUPAC name | 5-chloro-N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2-hydroxy-3-iodobenzamide |
| InChIKey | XGTQWEPDCQCNBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C2=CC(=C(C=C2)Cl)NC(=O)C3=C(C(=CC(=C3)Cl)I)O)Cl |
Computed by PubChem (NCBI)