CAS 315228-23-0 is the registry number for 3–(2,6–Dichloro–4–nitrophenoxy)quinoline. Offered by: GLPBio. Available pack sizes: 100mg.
3-(2,6-dichloro-4-nitrophenoxy)quinoline (CAS 315228-23-0) is a chemical compound with the molecular formula C15H8Cl2N2O3 and a molecular weight of 335.1 g/mol. IUPAC name: 3-(2,6-dichloro-4-nitrophenoxy)quinoline. InChIKey: VFWOGCBNSCFZGM-UHFFFAOYSA-N.
| Molecular formula | C15H8Cl2N2O3 |
|---|---|
| Molecular weight | 335.1 g/mol |
| IUPAC name | 3-(2,6-dichloro-4-nitrophenoxy)quinoline |
| InChIKey | VFWOGCBNSCFZGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)OC3=C(C=C(C=C3Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)