CAS 315233-63-7 is the registry number for 7-Hydroxy-3-(4-methoxy-phenyl)-2-trifluoromethyl-chromen-4-one, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
7-hydroxy-3-(4-methoxyphenyl)-2-(trifluoromethyl)chromen-4-one (CAS 315233-63-7) is a chemical compound with the molecular formula C17H11F3O4 and a molecular weight of 336.26 g/mol. IUPAC name: 7-hydroxy-3-(4-methoxyphenyl)-2-(trifluoromethyl)chromen-4-one. InChIKey: ZUXJYWAFEHIOHI-UHFFFAOYSA-N.
| Molecular formula | C17H11F3O4 |
|---|---|
| Molecular weight | 336.26 g/mol |
| IUPAC name | 7-hydroxy-3-(4-methoxyphenyl)-2-(trifluoromethyl)chromen-4-one |
| InChIKey | ZUXJYWAFEHIOHI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(OC3=C(C2=O)C=CC(=C3)O)C(F)(F)F |
Computed by PubChem (NCBI)