CAS 31545-35-4 appears in our catalog under these names: 1-(3,5-Dibromopyridin-2-yl)thiourea, 96%, 1-(3,5-Dibromopyridin-2-yl)thiourea, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
(3,5-dibromo-2-pyridinyl)thiourea (CAS 31545-35-4) is a chemical compound with the molecular formula C6H5Br2N3S and a molecular weight of 311.00 g/mol. IUPAC name: (3,5-dibromo-2-pyridinyl)thiourea. InChIKey: XIMYCSKDDBMLSY-UHFFFAOYSA-N.
| Molecular formula | C6H5Br2N3S |
|---|---|
| Molecular weight | 311.00 g/mol |
| IUPAC name | (3,5-dibromo-2-pyridinyl)thiourea |
| InChIKey | XIMYCSKDDBMLSY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)NC(=S)N)Br |
Computed by PubChem (NCBI)