Products 315495-26-2

CAS 315495-26-2 is the registry number for (E)-2-(4-Bromophenyl)ethene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g, 2g.

Structural formula: {0} (CAS {1})

(E)-2-(4-bromophenyl)ethenesulfonyl chloride (CAS 315495-26-2) is a chemical compound with the molecular formula C8H6BrClO2S and a molecular weight of 281.55 g/mol. IUPAC name: (E)-2-(4-bromophenyl)ethenesulfonyl chloride. InChIKey: QAAQAKSRVIIUEV-AATRIKPKSA-N.

Identity
Molecular formulaC8H6BrClO2S
Molecular weight281.55 g/mol
IUPAC name(E)-2-(4-bromophenyl)ethenesulfonyl chloride
InChIKeyQAAQAKSRVIIUEV-AATRIKPKSA-N
SMILESC1=CC(=CC=C1/C=C/S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)