CAS 315495-26-2 is the registry number for (E)-2-(4-Bromophenyl)ethene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g, 2g.
(E)-2-(4-bromophenyl)ethenesulfonyl chloride (CAS 315495-26-2) is a chemical compound with the molecular formula C8H6BrClO2S and a molecular weight of 281.55 g/mol. IUPAC name: (E)-2-(4-bromophenyl)ethenesulfonyl chloride. InChIKey: QAAQAKSRVIIUEV-AATRIKPKSA-N.
| Molecular formula | C8H6BrClO2S |
|---|---|
| Molecular weight | 281.55 g/mol |
| IUPAC name | (E)-2-(4-bromophenyl)ethenesulfonyl chloride |
| InChIKey | QAAQAKSRVIIUEV-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)