Products 31554-48-0

CAS 31554-48-0 is the registry number for 3-(Bromomethyl)-2,5-dihydrothiophene 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(bromomethyl)-2,5-dihydrothiophene 1,1-dioxide (CAS 31554-48-0) is a chemical compound with the molecular formula C5H7BrO2S and a molecular weight of 211.08 g/mol. IUPAC name: 3-(bromomethyl)-2,5-dihydrothiophene 1,1-dioxide. InChIKey: OQRRQSOMYYJAFE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7BrO2S
Molecular weight211.08 g/mol
IUPAC name3-(bromomethyl)-2,5-dihydrothiophene 1,1-dioxide
InChIKeyOQRRQSOMYYJAFE-UHFFFAOYSA-N
SMILESC1C=C(CS1(=O)=O)CBr

Computed by PubChem (NCBI)