CAS 315664-57-4 appears in our catalog under these names: 5,5'–(hydroxyphosphoryl)diisophthalic acid, 5,5'-(hydroxyphosphoryl)diisophthalic acid, 95%, 95%, 5,5'-(Hydroxyphosphoryl)diisophthalic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-[(3,5-dicarboxyphenyl)-hydroxyphosphoryl]benzene-1,3-dicarboxylic acid (CAS 315664-57-4) is a chemical compound with the molecular formula C16H11O10P and a molecular weight of 394.23 g/mol. IUPAC name: 5-[(3,5-dicarboxyphenyl)-hydroxyphosphoryl]benzene-1,3-dicarboxylic acid. InChIKey: NIOQUEOMFLZFJG-UHFFFAOYSA-N.
| Molecular formula | C16H11O10P |
|---|---|
| Molecular weight | 394.23 g/mol |
| IUPAC name | 5-[(3,5-dicarboxyphenyl)-hydroxyphosphoryl]benzene-1,3-dicarboxylic acid |
| InChIKey | NIOQUEOMFLZFJG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)P(=O)(C2=CC(=CC(=C2)C(=O)O)C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)