CAS 315671-37-5 is the registry number for 4-(2-(2-(2,4-Dichlorophenoxy)acetyl)hydrazinyl)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]-4-oxobutanoic acid (CAS 315671-37-5) is a chemical compound with the molecular formula C12H12Cl2N2O5 and a molecular weight of 335.14 g/mol. IUPAC name: 4-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]-4-oxobutanoic acid. InChIKey: NILLYZSLQMQPCQ-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O5 |
|---|---|
| Molecular weight | 335.14 g/mol |
| IUPAC name | 4-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]-4-oxobutanoic acid |
| InChIKey | NILLYZSLQMQPCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)NNC(=O)CCC(=O)O |
Computed by PubChem (NCBI)