Products 315671-37-5

CAS 315671-37-5 is the registry number for 4-(2-(2-(2,4-Dichlorophenoxy)acetyl)hydrazinyl)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]-4-oxobutanoic acid (CAS 315671-37-5) is a chemical compound with the molecular formula C12H12Cl2N2O5 and a molecular weight of 335.14 g/mol. IUPAC name: 4-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]-4-oxobutanoic acid. InChIKey: NILLYZSLQMQPCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12Cl2N2O5
Molecular weight335.14 g/mol
IUPAC name4-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]-4-oxobutanoic acid
InChIKeyNILLYZSLQMQPCQ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)OCC(=O)NNC(=O)CCC(=O)O

Computed by PubChem (NCBI)