CAS 315702-87-5 appears in our catalog under these names: 3-((4-(Pyridin-2-yl)thiazol-2-yl)amino)benzoic acid, 95+%, 3-((4-(Pyridin-2-yl)thiazol-2-yl)amino)benzoic acid, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]benzoic acid (CAS 315702-87-5) is a chemical compound with the molecular formula C15H11N3O2S and a molecular weight of 297.3 g/mol. IUPAC name: 3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]benzoic acid. InChIKey: AHNQVGWWBKRTON-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O2S |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]benzoic acid |
| InChIKey | AHNQVGWWBKRTON-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CSC(=N2)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)