CAS 315702-93-3 is the registry number for HBF-0079. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-pyridin-2-yl-N-pyrimidin-2-yl-1,3-thiazol-2-amine (CAS 315702-93-3) is a chemical compound with the molecular formula C12H9N5S and a molecular weight of 255.30 g/mol. IUPAC name: 4-pyridin-2-yl-N-pyrimidin-2-yl-1,3-thiazol-2-amine. InChIKey: QAINFPRHEISSOY-UHFFFAOYSA-N.
| Molecular formula | C12H9N5S |
|---|---|
| Molecular weight | 255.30 g/mol |
| IUPAC name | 4-pyridin-2-yl-N-pyrimidin-2-yl-1,3-thiazol-2-amine |
| InChIKey | QAINFPRHEISSOY-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CSC(=N2)NC3=NC=CC=N3 |
Computed by PubChem (NCBI)