CAS 315704-66-6 appears in our catalog under these names: Ptc-209, 95%, PTC-209/ 99.43% (existing batch purity), PTC–209, PTC 209, PTC-209 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 500mg, 2mg, 5mg, 10mg, 50mg, 10mM (in 1ml dmso), 1mg.
N-(2,6-dibromo-4-methoxyphenyl)-4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-amine (CAS 315704-66-6) is a chemical compound with the molecular formula C17H13Br2N5OS and a molecular weight of 495.2 g/mol. IUPAC name: N-(2,6-dibromo-4-methoxyphenyl)-4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-amine. InChIKey: XVOOCQSWCCRVDY-UHFFFAOYSA-N.
| Molecular formula | C17H13Br2N5OS |
|---|---|
| Molecular weight | 495.2 g/mol |
| IUPAC name | N-(2,6-dibromo-4-methoxyphenyl)-4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-amine |
| InChIKey | XVOOCQSWCCRVDY-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=CC=NC2=N1)C3=CSC(=N3)NC4=C(C=C(C=C4Br)OC)Br |
Computed by PubChem (NCBI)