CAS 31574-87-5 appears in our catalog under these names: 2,8–Dibromodibenzothiophene, 2,8-Dibromodibenzothiophene, 2,8-Dibromodibenzothiophene, >96.0%(GC), 2,8-Dibromodibenzo[b,d]thiophene 97%, 2,8-Dibromodibenzo[b,d]thiophene, 95%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 250mg, 10g, 500g.
2,8-dibromodibenzothiophene (CAS 31574-87-5) is a chemical compound with the molecular formula C12H6Br2S and a molecular weight of 342.05 g/mol. IUPAC name: 2,8-dibromodibenzothiophene. InChIKey: WNEXSUAHKVAPFK-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2S |
|---|---|
| Molecular weight | 342.05 g/mol |
| IUPAC name | 2,8-dibromodibenzothiophene |
| InChIKey | WNEXSUAHKVAPFK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C3=C(S2)C=CC(=C3)Br |
Computed by PubChem (NCBI)