CAS 3161-15-7 is the registry number for A 9387. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-bromo-6-(3-bromo-5-chloro-2-hydroxyphenyl)sulfanyl-4-chlorophenol (CAS 3161-15-7) is a chemical compound with the molecular formula C12H6Br2Cl2O2S and a molecular weight of 445.0 g/mol. IUPAC name: 2-bromo-6-(3-bromo-5-chloro-2-hydroxyphenyl)sulfanyl-4-chlorophenol. InChIKey: GAKNPUYHWSZTIO-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2Cl2O2S |
|---|---|
| Molecular weight | 445.0 g/mol |
| IUPAC name | 2-bromo-6-(3-bromo-5-chloro-2-hydroxyphenyl)sulfanyl-4-chlorophenol |
| InChIKey | GAKNPUYHWSZTIO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1SC2=C(C(=CC(=C2)Cl)Br)O)O)Br)Cl |
Computed by PubChem (NCBI)