Products 316124-91-1
CAS 316124-91-1 is the registry number for Ethyl 2-((2-isobutyl-8-((4-methylphenyl)sulfonamido)quinolin-6-yl)oxy)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[8-[(4-methylphenyl)sulfonylamino]-2-(2-methylpropyl)quinolin-6-yl]oxyacetate (CAS 316124-91-1) is a chemical compound with the molecular formula C24H28N2O5S and a molecular weight of 456.6 g/mol. IUPAC name: ethyl 2-[8-[(4-methylphenyl)sulfonylamino]-2-(2-methylpropyl)quinolin-6-yl]oxyacetate. InChIKey: POSCMZAFMIECJQ-UHFFFAOYSA-N.
| Molecular formula | C24H28N2O5S |
|---|---|
| Molecular weight | 456.6 g/mol |
| IUPAC name | ethyl 2-[8-[(4-methylphenyl)sulfonylamino]-2-(2-methylpropyl)quinolin-6-yl]oxyacetate |
| InChIKey | POSCMZAFMIECJQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=CC(=C2C(=C1)C=CC(=N2)CC(C)C)NS(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)