CAS 316133-27-4 is the registry number for N'-(1-(3-Aminophenyl)ethylidene)-[1,1'-biphenyl]-4-carbohydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(E)-1-(3-aminophenyl)ethylideneamino]-4-phenylbenzamide (CAS 316133-27-4) is a chemical compound with the molecular formula C21H19N3O and a molecular weight of 329.4 g/mol. IUPAC name: N-[(E)-1-(3-aminophenyl)ethylideneamino]-4-phenylbenzamide. InChIKey: ROOSDNAXRADJFF-HZHRSRAPSA-N.
| Molecular formula | C21H19N3O |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | N-[(E)-1-(3-aminophenyl)ethylideneamino]-4-phenylbenzamide |
| InChIKey | ROOSDNAXRADJFF-HZHRSRAPSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC=C(C=C1)C2=CC=CC=C2)/C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)