CAS 316149-01-6 appears in our catalog under these names: Etoricoxib Impurity 10, 5-Chloro-6'-methyl-3-(4-(methylsulfinyl)phenyl)-2,3'-bipyridine, 5-Chloro-2-(6-methylpyridin-3-yl)-3-(4-methylsulfinylphenyl)pyridine, 5-Chloro-6'-methyl-3-(4-(methylsulfinyl)phenyl)-2,3'-bipyridine (Etoricoxib Impurity), 98%, 98%, Etoricoxib impurity 10, 99.93%. Offered by: Chemat Brand, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 50mg, 25mg, 100mg, 250mg, 10 mg, 25 mg, 100 mg.
5-chloro-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfinylphenyl)pyridine (CAS 316149-01-6) is a chemical compound with the molecular formula C18H15ClN2OS and a molecular weight of 342.8 g/mol. IUPAC name: 5-chloro-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfinylphenyl)pyridine. InChIKey: SLXXLDBGJKCVGS-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2OS |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 5-chloro-2-(6-methyl-3-pyridinyl)-3-(4-methylsulfinylphenyl)pyridine |
| InChIKey | SLXXLDBGJKCVGS-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=C(C=C(C=N2)Cl)C3=CC=C(C=C3)S(=O)C |
Computed by PubChem (NCBI)