CAS 31635-99-1 appears in our catalog under these names: Sodium mesoxalate monohydrate, 98%, Mesoxalate sodium (monohydrate), Mesoxalate sodium (monohydrate), Sodium mesoxalate monohydrate, 98.00%, Sodium mesoxalate monohydrate, ≥98%(RT), ≥98%(RT). Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 500mg, 100mg, 10g, 125g, 500 mg.
Disodium;2,2-dihydroxypropanedioate (CAS 31635-99-1) is a chemical compound with the molecular formula C3H2Na2O6 and a molecular weight of 180.02 g/mol. IUPAC name: disodium;2,2-dihydroxypropanedioate. InChIKey: HMBGDJCPFGQLIO-UHFFFAOYSA-L.
| Molecular formula | C3H2Na2O6 |
|---|---|
| Molecular weight | 180.02 g/mol |
| IUPAC name | disodium;2,2-dihydroxypropanedioate |
| InChIKey | HMBGDJCPFGQLIO-UHFFFAOYSA-L |
| SMILES | C(=O)(C(C(=O)[O-])(O)O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)