Products 316371-83-2
CAS 316371-83-2 is the registry number for Rosiglitazone (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione (CAS 316371-83-2) is a chemical compound with the molecular formula C18H18N3NaO3S and a molecular weight of 379.4 g/mol. IUPAC name: sodium 5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione. InChIKey: XFOHHIYSRDUSCX-UHFFFAOYSA-M.
| Molecular formula | C18H18N3NaO3S |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | sodium 5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione |
| InChIKey | XFOHHIYSRDUSCX-UHFFFAOYSA-M |
| SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)[N-]C(=O)S2)C3=CC=CC=N3.[Na+] |
Computed by PubChem (NCBI)