Products 3166-15-2
CAS 3166-15-2 is the registry number for 9H-Thioxanthen-9-one 10,10-Dioxide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
10,10-dioxothioxanthen-9-one (CAS 3166-15-2) is a chemical compound with the molecular formula C13H8O3S and a molecular weight of 244.27 g/mol. IUPAC name: 10,10-dioxothioxanthen-9-one. InChIKey: DRIRMYPZOAOUPR-UHFFFAOYSA-N.
| Molecular formula | C13H8O3S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 10,10-dioxothioxanthen-9-one |
| InChIKey | DRIRMYPZOAOUPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3S2(=O)=O |
Computed by PubChem (NCBI)
Synonyms:
Thioxanthen-9-one 10,10-dioxide, 10,10-dioxothioxanthen-9-one, 9H-thioxanthen-9-one 10,10-dioxide, Thioxanthone S,S-dioxide, thioxanthen-9-one-10,10-dioxide, Thioxanthen-9-one, 10,10-dioxide, 9-oxo-9H-thioxanthene-10,10-dioxide, 9H-Thioxanthen-9-one, 10,10-dioxide, 1010dioxothioxanthen9one, THIOXANTHONESSDIOXIDE