CAS 31681-98-8 appears in our catalog under these names: Sodium-b-naphthyl acid phosphate, 95%, Sodium naphthalen-2-yl phosphate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
Disodium;naphthalen-2-yl hydrogen phosphate (CAS 31681-98-8) is a chemical compound with the molecular formula C10H8Na2O4P+ and a molecular weight of 269.12 g/mol. IUPAC name: disodium;naphthalen-2-yl hydrogen phosphate. InChIKey: HZCLXKFIXXQHKE-UHFFFAOYSA-M.
| Molecular formula | C10H8Na2O4P+ |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | disodium;naphthalen-2-yl hydrogen phosphate |
| InChIKey | HZCLXKFIXXQHKE-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OP(=O)(O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)