CAS 31696-67-0 appears in our catalog under these names: 2-Hydroxy-9H-thioxanthen-9-one, >95% (HPLC), 2-Hydroxythioxanthone, 9H-Thioxanthen-9-one, 2-hydroxy-, 95%, 95%, 2-Hydroxythioxanthone, min. 95 %, 50 mg, 2-Hydroxythioxanthone, min. 95 %, 100 mg. Offered by: TRC, Biosynth, Chemat, Roth, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 0,1g, 0,05g, 0,25g, 0,5g, 10g.
2-hydroxythioxanthen-9-one (CAS 31696-67-0) is a chemical compound with the molecular formula C13H8O2S and a molecular weight of 228.27 g/mol. IUPAC name: 2-hydroxythioxanthen-9-one. InChIKey: ANHLDZMOXDYFMQ-UHFFFAOYSA-N.
| Molecular formula | C13H8O2S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 2-hydroxythioxanthen-9-one |
| InChIKey | ANHLDZMOXDYFMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2)C=CC(=C3)O |
Computed by PubChem (NCBI)