CAS 31710-39-1 is the registry number for 2,2'-Di-tert-butyl-5,5'-dimethyl-4,4'-sulfinyl-di-phenol, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfinyl-5-methylphenol (CAS 31710-39-1) is a chemical compound with the molecular formula C22H30O3S and a molecular weight of 374.5 g/mol. IUPAC name: 2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfinyl-5-methylphenol. InChIKey: UZGWOIVYFUKNDE-UHFFFAOYSA-N.
| Molecular formula | C22H30O3S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfinyl-5-methylphenol |
| InChIKey | UZGWOIVYFUKNDE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)C2=CC(=C(C=C2C)O)C(C)(C)C)C(C)(C)C)O |
Computed by PubChem (NCBI)