CAS 317319-27-0 is the registry number for 2-(3-Fluoro-4-(trifluoromethyl)phenyl)-4-methyl-5-hydroxymethyl Thiazole. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
[2-[3-fluoro-4-(trifluoromethyl)phenyl]-4-methyl-1,3-thiazol-5-yl]methanol (CAS 317319-27-0) is a chemical compound with the molecular formula C12H9F4NOS and a molecular weight of 291.27 g/mol. IUPAC name: [2-[3-fluoro-4-(trifluoromethyl)phenyl]-4-methyl-1,3-thiazol-5-yl]methanol. InChIKey: SSJKNJYBSHISNC-UHFFFAOYSA-N.
| Molecular formula | C12H9F4NOS |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | [2-[3-fluoro-4-(trifluoromethyl)phenyl]-4-methyl-1,3-thiazol-5-yl]methanol |
| InChIKey | SSJKNJYBSHISNC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)C(F)(F)F)F)CO |
Computed by PubChem (NCBI)