Products 317321-89-4
CAS 317321-89-4 is the registry number for BAS00602705, 98.96%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10 mg, 100 mg, 50 mg.
Benzyl N-[1-(4-bromoanilino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate (CAS 317321-89-4) is a chemical compound with the molecular formula C25H22BrN3O3 and a molecular weight of 492.4 g/mol. IUPAC name: benzyl N-[1-(4-bromoanilino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate. InChIKey: PODWVIXNCKDPAZ-UHFFFAOYSA-N.
| Molecular formula | C25H22BrN3O3 |
|---|---|
| Molecular weight | 492.4 g/mol |
| IUPAC name | benzyl N-[1-(4-bromoanilino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
| InChIKey | PODWVIXNCKDPAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)NC4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)