CAS 317323-77-6 appears in our catalog under these names: Paroxetine Impurity 19, Paroxetine Impurity 38, Paroxol Tosylate, >95% (HPLC), (3S,4R)-4-(4-Fluorophenyl)-1-methyl-3-piperidinemethanol 3-(4-Methylbenzenesulfonate). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
[(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methyl 4-methylbenzenesulfonate (CAS 317323-77-6) is a chemical compound with the molecular formula C20H24FNO3S and a molecular weight of 377.5 g/mol. IUPAC name: [(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methyl 4-methylbenzenesulfonate. InChIKey: LYVSPZZHZZMALL-PXNSSMCTSA-N.
| Molecular formula | C20H24FNO3S |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | [(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | LYVSPZZHZZMALL-PXNSSMCTSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2CN(CC[C@H]2C3=CC=C(C=C3)F)C |
Computed by PubChem (NCBI)