CAS 317326-90-2 is the registry number for HLI98C. Offered by: MedChemExpress. Available pack sizes: Get quote.
10-(3-chlorophenyl)-7-nitropyrimido[4,5-b]quinoline-2,4-dione (CAS 317326-90-2) is a chemical compound with the molecular formula C17H9ClN4O4 and a molecular weight of 368.7 g/mol. IUPAC name: 10-(3-chlorophenyl)-7-nitropyrimido[4,5-b]quinoline-2,4-dione. InChIKey: BRCGPVHRBGGGPW-UHFFFAOYSA-N.
| Molecular formula | C17H9ClN4O4 |
|---|---|
| Molecular weight | 368.7 g/mol |
| IUPAC name | 10-(3-chlorophenyl)-7-nitropyrimido[4,5-b]quinoline-2,4-dione |
| InChIKey | BRCGPVHRBGGGPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C3=C(C=C(C=C3)[N+](=O)[O-])C=C4C2=NC(=O)NC4=O |
Computed by PubChem (NCBI)