CAS 317356-90-4 is the registry number for rel-(2R,4S)-tert-Butyl 4-fluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,4R)-4-fluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 317356-90-4) is a chemical compound with the molecular formula C10H18FNO3 and a molecular weight of 219.25 g/mol. IUPAC name: tert-butyl (2S,4R)-4-fluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: ROEMZCLHRRRKGF-SFYZADRCSA-N.
| Molecular formula | C10H18FNO3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | tert-butyl (2S,4R)-4-fluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | ROEMZCLHRRRKGF-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1CO)F |
Computed by PubChem (NCBI)