CAS 31780-23-1 is the registry number for Bisphenol C-Phosgene Copolymer. Offered by: TRC. Available pack sizes: 5g.
[4-[2-(4-methoxy-3-methylphenyl)propan-2-yl]-2-methylphenyl] acetate;hydrochloride (CAS 31780-23-1) is a chemical compound with the molecular formula C20H25ClO3 and a molecular weight of 348.9 g/mol. IUPAC name: [4-[2-(4-methoxy-3-methylphenyl)propan-2-yl]-2-methylphenyl] acetate;hydrochloride. InChIKey: PDRPQJYAPFFFAR-UHFFFAOYSA-N.
| Molecular formula | C20H25ClO3 |
|---|---|
| Molecular weight | 348.9 g/mol |
| IUPAC name | [4-[2-(4-methoxy-3-methylphenyl)propan-2-yl]-2-methylphenyl] acetate;hydrochloride |
| InChIKey | PDRPQJYAPFFFAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C)(C)C2=CC(=C(C=C2)OC(=O)C)C)OC.Cl |
Computed by PubChem (NCBI)