Products 318237-87-5
CAS 318237-87-5 is the registry number for Ethyl 2,4-dioxo-3-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
Ethyl 2,4-dioxo-3-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate (CAS 318237-87-5) is a chemical compound with the molecular formula C15H12F3NO4 and a molecular weight of 327.25 g/mol. IUPAC name: ethyl 2,4-dioxo-3-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate. InChIKey: NZBQUPPEQIVYQC-UHFFFAOYSA-N.
| Molecular formula | C15H12F3NO4 |
|---|---|
| Molecular weight | 327.25 g/mol |
| IUPAC name | ethyl 2,4-dioxo-3-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| InChIKey | NZBQUPPEQIVYQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2C1C(=O)N(C2=O)C3=CC=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)