CAS 318239-67-7 is the registry number for (5-(4-Chlorophenoxy)-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl)methanol, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
[5-(4-chlorophenoxy)-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methanol (CAS 318239-67-7) is a chemical compound with the molecular formula C12H10ClF3N2O2 and a molecular weight of 306.67 g/mol. IUPAC name: [5-(4-chlorophenoxy)-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methanol. InChIKey: DIVFCQKXUCIGKZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClF3N2O2 |
|---|---|
| Molecular weight | 306.67 g/mol |
| IUPAC name | [5-(4-chlorophenoxy)-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methanol |
| InChIKey | DIVFCQKXUCIGKZ-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(F)(F)F)CO)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)