CAS 318250-08-7 is the registry number for (11R)-[1,1'-Binaphthalen]-2-ylbis(3,5-dimethylphenyl)phosphane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(3,5-dimethylphenyl)-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane (CAS 318250-08-7) is a chemical compound with the molecular formula C36H31P and a molecular weight of 494.6 g/mol. IUPAC name: bis(3,5-dimethylphenyl)-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane. InChIKey: FFRNGIWZRXFPDR-UHFFFAOYSA-N.
| Molecular formula | C36H31P |
|---|---|
| Molecular weight | 494.6 g/mol |
| IUPAC name | bis(3,5-dimethylphenyl)-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane |
| InChIKey | FFRNGIWZRXFPDR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)P(C2=C(C3=CC=CC=C3C=C2)C4=CC=CC5=CC=CC=C54)C6=CC(=CC(=C6)C)C)C |
Computed by PubChem (NCBI)