CAS 318256-23-4 is the registry number for Methyl 5-(3,4-dichlorophenyl)-1-(3,5-dichlorophenyl)-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
Methyl 5-(3,4-dichlorophenyl)-1-(3,5-dichlorophenyl)pyrazole-3-carboxylate (CAS 318256-23-4) is a chemical compound with the molecular formula C17H10Cl4N2O2 and a molecular weight of 416.1 g/mol. IUPAC name: methyl 5-(3,4-dichlorophenyl)-1-(3,5-dichlorophenyl)pyrazole-3-carboxylate. InChIKey: AONFJKOPISXDTI-UHFFFAOYSA-N.
| Molecular formula | C17H10Cl4N2O2 |
|---|---|
| Molecular weight | 416.1 g/mol |
| IUPAC name | methyl 5-(3,4-dichlorophenyl)-1-(3,5-dichlorophenyl)pyrazole-3-carboxylate |
| InChIKey | AONFJKOPISXDTI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C(=C1)C2=CC(=C(C=C2)Cl)Cl)C3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)