CAS 31845-00-8 is the registry number for 4-Bromo-5-nitrothiophene-2-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-5-nitrothiophene-2-carbonitrile (CAS 31845-00-8) is a chemical compound with the molecular formula C5HBrN2O2S and a molecular weight of 233.04 g/mol. IUPAC name: 4-bromo-5-nitrothiophene-2-carbonitrile. InChIKey: WHIYTPLNDQYIBZ-UHFFFAOYSA-N.
| Molecular formula | C5HBrN2O2S |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | 4-bromo-5-nitrothiophene-2-carbonitrile |
| InChIKey | WHIYTPLNDQYIBZ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Br)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)