CAS 318471-58-8 is the registry number for Diethyl 2-(2-fluoro-4-nitrophenyl)malonate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
Diethyl 2-(2-fluoro-4-nitrophenyl)propanedioate (CAS 318471-58-8) is a chemical compound with the molecular formula C13H14FNO6 and a molecular weight of 299.25 g/mol. IUPAC name: diethyl 2-(2-fluoro-4-nitrophenyl)propanedioate. InChIKey: RZYIUPASHFMODF-UHFFFAOYSA-N.
| Molecular formula | C13H14FNO6 |
|---|---|
| Molecular weight | 299.25 g/mol |
| IUPAC name | diethyl 2-(2-fluoro-4-nitrophenyl)propanedioate |
| InChIKey | RZYIUPASHFMODF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=C(C=C1)[N+](=O)[O-])F)C(=O)OCC |
Computed by PubChem (NCBI)