CAS 318488-01-6 is the registry number for 5,15-Bis(4-bromophenyl)-21H,23H-porphine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,15-bis(4-bromophenyl)-21,22-dihydroporphyrin (CAS 318488-01-6) is a chemical compound with the molecular formula C32H20Br2N4 and a molecular weight of 620.3 g/mol. IUPAC name: 5,15-bis(4-bromophenyl)-21,22-dihydroporphyrin. InChIKey: OAGGGFHYKDWYHL-UHFFFAOYSA-N.
| Molecular formula | C32H20Br2N4 |
|---|---|
| Molecular weight | 620.3 g/mol |
| IUPAC name | 5,15-bis(4-bromophenyl)-21,22-dihydroporphyrin |
| InChIKey | OAGGGFHYKDWYHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3C=CC(=CC4=NC(=C(C5=NC(=CC6=CC=C2N6)C=C5)C7=CC=C(C=C7)Br)C=C4)N3)Br |
Computed by PubChem (NCBI)