CAS 318502-89-5 is the registry number for (3Ar,7as)-rel-2-boc-5-hydroxy-octahydro-2h-isoindole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl (3aR,7aS)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (CAS 318502-89-5) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl (3aR,7aS)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate. InChIKey: ISZLPPFTZXTGHT-JKIOLJMWSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl (3aR,7aS)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| InChIKey | ISZLPPFTZXTGHT-JKIOLJMWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CCC(C[C@H]2C1)O |
Computed by PubChem (NCBI)