CAS 3192-06-1 is the registry number for 3,4-Dihydro-1H-2lambda6,1-benzothiazine-2,2-dione, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3,4-dihydro-1H-2lambda6,1-benzothiazine 2,2-dioxide (CAS 3192-06-1) is a chemical compound with the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. IUPAC name: 3,4-dihydro-1H-2lambda6,1-benzothiazine 2,2-dioxide. InChIKey: SFUUSVZJOLXBIB-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2S |
|---|---|
| Molecular weight | 183.23 g/mol |
| IUPAC name | 3,4-dihydro-1H-2lambda6,1-benzothiazine 2,2-dioxide |
| InChIKey | SFUUSVZJOLXBIB-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)NC2=CC=CC=C21 |
Computed by PubChem (NCBI)