CAS 3198-38-7 is the registry number for Decamethonium (chloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
Trimethyl-[10-(trimethylazaniumyl)decyl]azanium dichloride (CAS 3198-38-7) is a chemical compound with the molecular formula C16H38Cl2N2 and a molecular weight of 329.4 g/mol. IUPAC name: trimethyl-[10-(trimethylazaniumyl)decyl]azanium dichloride. InChIKey: KMVDECFGXJKYHV-UHFFFAOYSA-L.
| Molecular formula | C16H38Cl2N2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | trimethyl-[10-(trimethylazaniumyl)decyl]azanium dichloride |
| InChIKey | KMVDECFGXJKYHV-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C.[Cl-].[Cl-] |
Computed by PubChem (NCBI)