CAS 31982-77-1 appears in our catalog under these names: H–Ile–NHOH, H-Ile-NHOH, H-Ile-NHOH acetate salt. Offered by: GLPBio, Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 2g, 25g, 10g.
(2S,3S)-2-amino-N-hydroxy-3-methylpentanamide (CAS 31982-77-1) is a chemical compound with the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. IUPAC name: (2S,3S)-2-amino-N-hydroxy-3-methylpentanamide. InChIKey: GMKATDLSKRGLMZ-WHFBIAKZSA-N.
| Molecular formula | C6H14N2O2 |
|---|---|
| Molecular weight | 146.19 g/mol |
| IUPAC name | (2S,3S)-2-amino-N-hydroxy-3-methylpentanamide |
| InChIKey | GMKATDLSKRGLMZ-WHFBIAKZSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NO)N |
Computed by PubChem (NCBI)