Products 319906-76-8

CAS 319906-76-8 is the registry number for Idebenone Sulfate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl hydrogen sulfate (CAS 319906-76-8) is a chemical compound with the molecular formula C19H30O8S and a molecular weight of 418.5 g/mol. IUPAC name: 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl hydrogen sulfate. InChIKey: DTQUGHKSJDPRPK-UHFFFAOYSA-N.

Identity
Molecular formulaC19H30O8S
Molecular weight418.5 g/mol
IUPAC name10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl hydrogen sulfate
InChIKeyDTQUGHKSJDPRPK-UHFFFAOYSA-N
SMILESCC1=C(C(=O)C(=C(C1=O)OC)OC)CCCCCCCCCCOS(=O)(=O)O

Computed by PubChem (NCBI)