Products 2179051-09-1

CAS 2179051-09-1 is the registry number for 2-(3-(4-(3-(Tosyloxy)propoxy)butoxy)propoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[3-[4-[3-(4-methylphenyl)sulfonyloxypropoxy]butoxy]propoxy]acetic acid (CAS 2179051-09-1) is a chemical compound with the molecular formula C19H30O8S and a molecular weight of 418.5 g/mol. IUPAC name: 2-[3-[4-[3-(4-methylphenyl)sulfonyloxypropoxy]butoxy]propoxy]acetic acid. InChIKey: SXLLNSHZVJIMPY-UHFFFAOYSA-N.

Identity
Molecular formulaC19H30O8S
Molecular weight418.5 g/mol
IUPAC name2-[3-[4-[3-(4-methylphenyl)sulfonyloxypropoxy]butoxy]propoxy]acetic acid
InChIKeySXLLNSHZVJIMPY-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCCOCCCCOCCCOCC(=O)O

Computed by PubChem (NCBI)