CAS 319914-20-0 appears in our catalog under these names: 3-Hydroxy-4-methoxyphenylacetone, 95%, (3-Hydroxy-4-methoxyphenyl)acetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 2000mg.
1-(3-hydroxy-4-methoxyphenyl)propan-2-one (CAS 319914-20-0) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 1-(3-hydroxy-4-methoxyphenyl)propan-2-one. InChIKey: MEGNUKRPIVZDIU-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 1-(3-hydroxy-4-methoxyphenyl)propan-2-one |
| InChIKey | MEGNUKRPIVZDIU-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=C(C=C1)OC)O |
Computed by PubChem (NCBI)