Products 320-22-9
CAS 320-22-9 appears in our catalog under these names: 1,2-Dichloro-4,5-bis-(trifluoromethyl)benzene, 95%, 1,2-Bis(trifluoromethyl)-4,5-dichlorobenzene, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
1,2-dichloro-4,5-bis(trifluoromethyl)benzene (CAS 320-22-9) is a chemical compound with the molecular formula C8H2Cl2F6 and a molecular weight of 282.99 g/mol. IUPAC name: 1,2-dichloro-4,5-bis(trifluoromethyl)benzene. InChIKey: FHLISUPNJJTGGL-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F6 |
|---|---|
| Molecular weight | 282.99 g/mol |
| IUPAC name | 1,2-dichloro-4,5-bis(trifluoromethyl)benzene |
| InChIKey | FHLISUPNJJTGGL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)