CAS 320339-03-5 appears in our catalog under these names: 4–tert–Butyl–4'–iodobiphenyl, 4-tert-Butyl-4'-iodobiphenyl, >98.0%(GC), 4-tert-Butyl-4'-iodobiphenyl, 98.0%, 98.0%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 5g.
1-tert-butyl-4-(4-iodophenyl)benzene (CAS 320339-03-5) is a chemical compound with the molecular formula C16H17I and a molecular weight of 336.21 g/mol. IUPAC name: 1-tert-butyl-4-(4-iodophenyl)benzene. InChIKey: HPIHETXXQCHXAU-UHFFFAOYSA-N.
| Molecular formula | C16H17I |
|---|---|
| Molecular weight | 336.21 g/mol |
| IUPAC name | 1-tert-butyl-4-(4-iodophenyl)benzene |
| InChIKey | HPIHETXXQCHXAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)